About N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2-pyrrol-1-ylpentanamide
N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2-pyrrol-1-ylpentanamide (PubChem CID 118776566) has the molecular formula C17H26N4O
and a molecular weight of 302.42 g/mol. Its IUPAC name is N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2-pyrrol-1-ylpentanamide.
Molecular Properties
| Compound Name | N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2-pyrrol-1-ylpentanamide |
| PubChem CID | 118776566 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2-pyrrol-1-ylpentanamide |
| SMILES | CCCC(C(=O)NCc1c(C)nn(CC)c1C)n1cccc1 |
| InChI | InChI=1S/C17H26N4O/c1-5-9-16(20-10-7-8-11-20)17(22)18-12-15-13(3)19-21(6-2)14(15)4/h7-8,10-11,16H,5-6,9,12H2,1-4H3,(H,18,22) |
| InChIKey | YOZKJZXDEKGIBU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2-pyrrol-1-ylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2-pyrrol-1-ylpentanamide?
The IUPAC name of N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2-pyrrol-1-ylpentanamide (CID 118776566) is N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2-pyrrol-1-ylpentanamide.
What is the SMILES notation for N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2-pyrrol-1-ylpentanamide?
The canonical SMILES for N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2-pyrrol-1-ylpentanamide is CCCC(C(=O)NCc1c(C)nn(CC)c1C)n1cccc1.
What is the InChIKey of N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2-pyrrol-1-ylpentanamide?
The InChIKey is YOZKJZXDEKGIBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N4O/c1-5-9-16(20-10-7-8-11-20)17(22)18-12-15-13(3)19-21(6-2)14(15)4/h7-8,10-11,16H,5-6,9,12H2,1-4H3,(H,18,22).
What are the key properties of N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2-pyrrol-1-ylpentanamide?
N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2-pyrrol-1-ylpentanamide has a molecular weight of 302.42 g/mol, XLogP of 2.98, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2-pyrrol-1-ylpentanamide is sourced from PubChem (CID 118776566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).