C19H21NO4S — CID 118776593
1-[3-(4-methylphenoxy)azetidin-1-yl]-2-(4-methylsulfonylphenyl)ethanone (PubChem CID 118776593) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is 1-[3-(4-methylphenoxy)azetidin-1-yl]-2-(4-methylsulfonylphenyl)ethanone.
| Compound Name | 1-[3-(4-methylphenoxy)azetidin-1-yl]-2-(4-methylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 118776593 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 1-[3-(4-methylphenoxy)azetidin-1-yl]-2-(4-methylsulfonylphenyl)ethanone |
| SMILES | Cc1ccc(OC2CN(C(=O)Cc3ccc(S(C)(=O)=O)cc3)C2)cc1 |
| InChI | InChI=1S/C19H21NO4S/c1-14-3-7-16(8-4-14)24-17-12-20(13-17)19(21)11-15-5-9-18(10-6-15)25(2,22)23/h3-10,17H,11-13H2,1-2H3 |
| InChIKey | DKJVECSSEZNWJO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |