About N-ethyl-N,N'-dimethyl-N'-[(4-methylthiadiazol-5-yl)methyl]propane-1,3-diamine
N-ethyl-N,N'-dimethyl-N'-[(4-methylthiadiazol-5-yl)methyl]propane-1,3-diamine (PubChem CID 118776621) has the molecular formula C11H22N4S
and a molecular weight of 242.39 g/mol. Its IUPAC name is N-ethyl-N,N'-dimethyl-N'-[(4-methylthiadiazol-5-yl)methyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N-ethyl-N,N'-dimethyl-N'-[(4-methylthiadiazol-5-yl)methyl]propane-1,3-diamine |
| PubChem CID | 118776621 |
| Molecular Formula | C11H22N4S |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | N-ethyl-N,N'-dimethyl-N'-[(4-methylthiadiazol-5-yl)methyl]propane-1,3-diamine |
| SMILES | CCN(C)CCCN(C)Cc1snnc1C |
| InChI | InChI=1S/C11H22N4S/c1-5-14(3)7-6-8-15(4)9-11-10(2)12-13-16-11/h5-9H2,1-4H3 |
| InChIKey | FIKGTZRUHHQOPX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-ethyl-N,N'-dimethyl-N'-[(4-methylthiadiazol-5-yl)methyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N,N'-dimethyl-N'-[(4-methylthiadiazol-5-yl)methyl]propane-1,3-diamine?
The IUPAC name of N-ethyl-N,N'-dimethyl-N'-[(4-methylthiadiazol-5-yl)methyl]propane-1,3-diamine (CID 118776621) is N-ethyl-N,N'-dimethyl-N'-[(4-methylthiadiazol-5-yl)methyl]propane-1,3-diamine.
What is the SMILES notation for N-ethyl-N,N'-dimethyl-N'-[(4-methylthiadiazol-5-yl)methyl]propane-1,3-diamine?
The canonical SMILES for N-ethyl-N,N'-dimethyl-N'-[(4-methylthiadiazol-5-yl)methyl]propane-1,3-diamine is CCN(C)CCCN(C)Cc1snnc1C.
What is the InChIKey of N-ethyl-N,N'-dimethyl-N'-[(4-methylthiadiazol-5-yl)methyl]propane-1,3-diamine?
The InChIKey is FIKGTZRUHHQOPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N4S/c1-5-14(3)7-6-8-15(4)9-11-10(2)12-13-16-11/h5-9H2,1-4H3.
What are the key properties of N-ethyl-N,N'-dimethyl-N'-[(4-methylthiadiazol-5-yl)methyl]propane-1,3-diamine?
N-ethyl-N,N'-dimethyl-N'-[(4-methylthiadiazol-5-yl)methyl]propane-1,3-diamine has a molecular weight of 242.39 g/mol, XLogP of 1.62, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N,N'-dimethyl-N'-[(4-methylthiadiazol-5-yl)methyl]propane-1,3-diamine is sourced from PubChem (CID 118776621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).