C20H27NO4S — CID 118776999
1-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecan-8-yl]-2-(2-methylphenyl)sulfanylethanone (PubChem CID 118776999) has the molecular formula C20H27NO4S and a molecular weight of 377.51 g/mol. Its IUPAC name is 1-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecan-8-yl]-2-(2-methylphenyl)sulfanylethanone.
| Compound Name | 1-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecan-8-yl]-2-(2-methylphenyl)sulfanylethanone |
|---|---|
| PubChem CID | 118776999 |
| Molecular Formula | C20H27NO4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 1-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecan-8-yl]-2-(2-methylphenyl)sulfanylethanone |
| SMILES | Cc1ccccc1SCC(=O)N1C[C@H]2COCC[C@@]2(O)[C@@H]2COCC[C@@H]21 |
| InChI | InChI=1S/C20H27NO4S/c1-14-4-2-3-5-18(14)26-13-19(22)21-10-15-11-25-9-7-20(15,23)16-12-24-8-6-17(16)21/h2-5,15-17,23H,6-13H2,1H3/t15-,16+,17-,20-/m0/s1 |
| InChIKey | AATGZITYCLQPHP-CLWJZODNSA-N |
| XLogP | 2.10 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |