C15H20N4O4 — CID 118777102
3-[2-(2,3-dimethyl-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)-2-oxoethyl]-1,3-oxazolidin-2-one (PubChem CID 118777102) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is 3-[2-(2,3-dimethyl-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)-2-oxoethyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-(2,3-dimethyl-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)-2-oxoethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 118777102 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 3-[2-(2,3-dimethyl-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)-2-oxoethyl]-1,3-oxazolidin-2-one |
| SMILES | Cc1nc2c(c(=O)n1C)CCN(C(=O)CN1CCOC1=O)CC2 |
| InChI | InChI=1S/C15H20N4O4/c1-10-16-12-4-6-18(5-3-11(12)14(21)17(10)2)13(20)9-19-7-8-23-15(19)22/h3-9H2,1-2H3 |
| InChIKey | YKKBBIHRVRZXIG-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |