C19H30N4O2 — CID 118777184
2-[(3R,4S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-(1-methyltriazol-4-yl)pyrrolidin-3-yl]acetic acid (PubChem CID 118777184) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 2-[(3R,4S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-(1-methyltriazol-4-yl)pyrrolidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-(1-methyltriazol-4-yl)pyrrolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 118777184 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 2-[(3R,4S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-(1-methyltriazol-4-yl)pyrrolidin-3-yl]acetic acid |
| SMILES | CC(C)=CCC/C(C)=C/CN1C[C@H](CC(=O)O)[C@H](c2cn(C)nn2)C1 |
| InChI | InChI=1S/C19H30N4O2/c1-14(2)6-5-7-15(3)8-9-23-11-16(10-19(24)25)17(12-23)18-13-22(4)21-20-18/h6,8,13,16-17H,5,7,9-12H2,1-4H3,(H,24,25)/b15-8+/t16-,17+/m0/s1 |
| InChIKey | ZJKJLTWZNDZYOC-UFWNIKGBSA-N |
| XLogP | 3.00 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|