About (5-methyl-1,3-oxazol-4-yl)-[4-(7H-purin-6-yl)piperazin-1-yl]methanone
(5-methyl-1,3-oxazol-4-yl)-[4-(7H-purin-6-yl)piperazin-1-yl]methanone (PubChem CID 118779921) has the molecular formula C14H15N7O2
and a molecular weight of 313.32 g/mol. Its IUPAC name is (5-methyl-1,3-oxazol-4-yl)-[4-(7H-purin-6-yl)piperazin-1-yl]methanone.
Molecular Properties
| Compound Name | (5-methyl-1,3-oxazol-4-yl)-[4-(7H-purin-6-yl)piperazin-1-yl]methanone |
| PubChem CID | 118779921 |
| Molecular Formula | C14H15N7O2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (5-methyl-1,3-oxazol-4-yl)-[4-(7H-purin-6-yl)piperazin-1-yl]methanone |
| SMILES | Cc1ocnc1C(=O)N1CCN(c2ncnc3nc[nH]c23)CC1 |
| InChI | InChI=1S/C14H15N7O2/c1-9-10(19-8-23-9)14(22)21-4-2-20(3-5-21)13-11-12(16-6-15-11)17-7-18-13/h6-8H,2-5H2,1H3,(H,15,16,17,18) |
| InChIKey | YQLDNMZWFNQGSI-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 104.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (5-methyl-1,3-oxazol-4-yl)-[4-(7H-purin-6-yl)piperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-1,3-oxazol-4-yl)-[4-(7H-purin-6-yl)piperazin-1-yl]methanone?
The IUPAC name of (5-methyl-1,3-oxazol-4-yl)-[4-(7H-purin-6-yl)piperazin-1-yl]methanone (CID 118779921) is (5-methyl-1,3-oxazol-4-yl)-[4-(7H-purin-6-yl)piperazin-1-yl]methanone.
What is the SMILES notation for (5-methyl-1,3-oxazol-4-yl)-[4-(7H-purin-6-yl)piperazin-1-yl]methanone?
The canonical SMILES for (5-methyl-1,3-oxazol-4-yl)-[4-(7H-purin-6-yl)piperazin-1-yl]methanone is Cc1ocnc1C(=O)N1CCN(c2ncnc3nc[nH]c23)CC1.
What is the InChIKey of (5-methyl-1,3-oxazol-4-yl)-[4-(7H-purin-6-yl)piperazin-1-yl]methanone?
The InChIKey is YQLDNMZWFNQGSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N7O2/c1-9-10(19-8-23-9)14(22)21-4-2-20(3-5-21)13-11-12(16-6-15-11)17-7-18-13/h6-8H,2-5H2,1H3,(H,15,16,17,18).
What are the key properties of (5-methyl-1,3-oxazol-4-yl)-[4-(7H-purin-6-yl)piperazin-1-yl]methanone?
(5-methyl-1,3-oxazol-4-yl)-[4-(7H-purin-6-yl)piperazin-1-yl]methanone has a molecular weight of 313.32 g/mol, XLogP of 0.61, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1,3-oxazol-4-yl)-[4-(7H-purin-6-yl)piperazin-1-yl]methanone is sourced from PubChem (CID 118779921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).