C15H19N5O4 — CID 118780336
3-[2-(2,3-dimethyl-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 118780336) has the molecular formula C15H19N5O4 and a molecular weight of 333.35 g/mol. Its IUPAC name is 3-[2-(2,3-dimethyl-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-(2,3-dimethyl-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 118780336 |
| Molecular Formula | C15H19N5O4 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 3-[2-(2,3-dimethyl-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | Cc1nc2c(c(=O)n1C)CCN(C(=O)CN1C(=O)CNC1=O)CC2 |
| InChI | InChI=1S/C15H19N5O4/c1-9-17-11-4-6-19(5-3-10(11)14(23)18(9)2)13(22)8-20-12(21)7-16-15(20)24/h3-8H2,1-2H3,(H,16,24) |
| InChIKey | QWUXZQXIIHNPPZ-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|