C14H17N3O3S2 — CID 118780626
N-[2-(dimethylsulfamoyl)ethyl]-3-(1,3-thiazol-2-yl)benzamide (PubChem CID 118780626) has the molecular formula C14H17N3O3S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[2-(dimethylsulfamoyl)ethyl]-3-(1,3-thiazol-2-yl)benzamide.
| Compound Name | N-[2-(dimethylsulfamoyl)ethyl]-3-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 118780626 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N-[2-(dimethylsulfamoyl)ethyl]-3-(1,3-thiazol-2-yl)benzamide |
| SMILES | CN(C)S(=O)(=O)CCNC(=O)c1cccc(-c2nccs2)c1 |
| InChI | InChI=1S/C14H17N3O3S2/c1-17(2)22(19,20)9-7-15-13(18)11-4-3-5-12(10-11)14-16-6-8-21-14/h3-6,8,10H,7,9H2,1-2H3,(H,15,18) |
| InChIKey | NXGRIRWDHNBKTR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |