C7H12Cl2O2 — CID 11878093
(1R,2S,4S,6S)-2,4-dichloro-6-(hydroxymethyl)cyclohexan-1-ol (PubChem CID 11878093) has the molecular formula C7H12Cl2O2 and a molecular weight of 199.08 g/mol. Its IUPAC name is (1R,2S,4S,6S)-2,4-dichloro-6-(hydroxymethyl)cyclohexan-1-ol.
| Compound Name | (1R,2S,4S,6S)-2,4-dichloro-6-(hydroxymethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 11878093 |
| Molecular Formula | C7H12Cl2O2 |
| Molecular Weight | 199.08 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | (1R,2S,4S,6S)-2,4-dichloro-6-(hydroxymethyl)cyclohexan-1-ol |
| SMILES | OC[C@@H]1C[C@H](Cl)C[C@H](Cl)[C@@H]1O |
| InChI | InChI=1S/C7H12Cl2O2/c8-5-1-4(3-10)7(11)6(9)2-5/h4-7,10-11H,1-3H2/t4-,5-,6-,7+/m0/s1 |
| InChIKey | KHXAEMABSWIAKK-ZTYPAOSTSA-N |
| XLogP | 0.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.08 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|