C18H29N3O2 — CID 118781216
(3aR,6S,7aS)-6-(cyclopropylmethoxy)-1-[2-(1H-imidazol-2-yl)ethyl]-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole (PubChem CID 118781216) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is (3aR,6S,7aS)-6-(cyclopropylmethoxy)-1-[2-(1H-imidazol-2-yl)ethyl]-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole.
| Compound Name | (3aR,6S,7aS)-6-(cyclopropylmethoxy)-1-[2-(1H-imidazol-2-yl)ethyl]-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole |
|---|---|
| PubChem CID | 118781216 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | (3aR,6S,7aS)-6-(cyclopropylmethoxy)-1-[2-(1H-imidazol-2-yl)ethyl]-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole |
| SMILES | CO[C@@]12CC[C@H](OCC3CC3)C[C@@H]1N(CCc1ncc[nH]1)CC2 |
| InChI | InChI=1S/C18H29N3O2/c1-22-18-6-4-15(23-13-14-2-3-14)12-16(18)21(11-7-18)10-5-17-19-8-9-20-17/h8-9,14-16H,2-7,10-13H2,1H3,(H,19,20)/t15-,16-,18+/m0/s1 |
| InChIKey | YYGKATAVKUMZCJ-XYJFISCASA-N |
| XLogP | 2.39 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |