C18H18O6 — CID 11878126
prop-2-enyl (1R,2aR,8bS)-1-acetyloxy-1-methyl-3-oxo-2,8b-dihydrocyclobuta[c]chromene-2a-carboxylate (PubChem CID 11878126) has the molecular formula C18H18O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is prop-2-enyl (1R,2aR,8bS)-1-acetyloxy-1-methyl-3-oxo-2,8b-dihydrocyclobuta[c]chromene-2a-carboxylate.
| Compound Name | prop-2-enyl (1R,2aR,8bS)-1-acetyloxy-1-methyl-3-oxo-2,8b-dihydrocyclobuta[c]chromene-2a-carboxylate |
|---|---|
| PubChem CID | 11878126 |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | prop-2-enyl (1R,2aR,8bS)-1-acetyloxy-1-methyl-3-oxo-2,8b-dihydrocyclobuta[c]chromene-2a-carboxylate |
| SMILES | C=CCOC(=O)[C@@]12C[C@@](C)(OC(C)=O)[C@H]1c1ccccc1OC2=O |
| InChI | InChI=1S/C18H18O6/c1-4-9-22-15(20)18-10-17(3,24-11(2)19)14(18)12-7-5-6-8-13(12)23-16(18)21/h4-8,14H,1,9-10H2,2-3H3/t14-,17-,18-/m1/s1 |
| InChIKey | OXEJIIKLRXTAFZ-ZTFGCOKTSA-N |
| XLogP | 2.13 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|