C17H24N4O3 — CID 118781555
[(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(1-methylimidazo[2,1-e]pyrazol-7-yl)methanone (PubChem CID 118781555) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is [(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(1-methylimidazo[2,1-e]pyrazol-7-yl)methanone.
| Compound Name | [(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(1-methylimidazo[2,1-e]pyrazol-7-yl)methanone |
|---|---|
| PubChem CID | 118781555 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | [(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(1-methylimidazo[2,1-e]pyrazol-7-yl)methanone |
| SMILES | CO[C@H]1CC[C@@]2(OC)CCN(C(=O)c3cnn4ccn(C)c34)[C@H]2C1 |
| InChI | InChI=1S/C17H24N4O3/c1-19-8-9-21-15(19)13(11-18-21)16(22)20-7-6-17(24-3)5-4-12(23-2)10-14(17)20/h8-9,11-12,14H,4-7,10H2,1-3H3/t12-,14-,17+/m0/s1 |
| InChIKey | FPSPWTNZSAZNCQ-RVSPLBMKSA-N |
| XLogP | 1.47 |
| TPSA | 61.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |