C26H24N2O3 — CID 11878229
methyl (6S,8R,9R)-9-methyl-6-naphthalen-2-yl-7-oxo-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepine-8-carboxylate (PubChem CID 11878229) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is methyl (6S,8R,9R)-9-methyl-6-naphthalen-2-yl-7-oxo-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepine-8-carboxylate.
| Compound Name | methyl (6S,8R,9R)-9-methyl-6-naphthalen-2-yl-7-oxo-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepine-8-carboxylate |
|---|---|
| PubChem CID | 11878229 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | methyl (6S,8R,9R)-9-methyl-6-naphthalen-2-yl-7-oxo-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepine-8-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)C2=C(C[C@H]1C)Nc1ccccc1N[C@H]2c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H24N2O3/c1-15-13-21-23(25(29)22(15)26(30)31-2)24(28-20-10-6-5-9-19(20)27-21)18-12-11-16-7-3-4-8-17(16)14-18/h3-12,14-15,22,24,27-28H,13H2,1-2H3/t15-,22-,24+/m1/s1 |
| InChIKey | JFDHLSJSCLORCK-CHVDNLQBSA-N |
| XLogP | 5.07 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|