C19H24ClNO4 — CID 118782338
2-(2-chlorophenyl)-1-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecan-8-yl]ethanone (PubChem CID 118782338) has the molecular formula C19H24ClNO4 and a molecular weight of 365.86 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecan-8-yl]ethanone.
| Compound Name | 2-(2-chlorophenyl)-1-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecan-8-yl]ethanone |
|---|---|
| PubChem CID | 118782338 |
| Molecular Formula | C19H24ClNO4 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-(2-chlorophenyl)-1-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecan-8-yl]ethanone |
| SMILES | O=C(Cc1ccccc1Cl)N1C[C@H]2COCC[C@@]2(O)[C@@H]2COCC[C@@H]21 |
| InChI | InChI=1S/C19H24ClNO4/c20-16-4-2-1-3-13(16)9-18(22)21-10-14-11-25-8-6-19(14,23)15-12-24-7-5-17(15)21/h1-4,14-15,17,23H,5-12H2/t14-,15+,17-,19-/m0/s1 |
| InChIKey | ZUFDVXWYNVNBQF-HIRMHNASSA-N |
| XLogP | 1.90 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |