C19H23N3O4 — CID 118782662
5-[(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-2-phenyl-1H-pyrazol-3-one (PubChem CID 118782662) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 5-[(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-2-phenyl-1H-pyrazol-3-one.
| Compound Name | 5-[(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-2-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 118782662 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 5-[(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-2-phenyl-1H-pyrazol-3-one |
| SMILES | CO[C@@]12CC[C@H](O)C[C@@H]1N(C(=O)c1cc(=O)n(-c3ccccc3)[nH]1)CC2 |
| InChI | InChI=1S/C19H23N3O4/c1-26-19-8-7-14(23)11-16(19)21(10-9-19)18(25)15-12-17(24)22(20-15)13-5-3-2-4-6-13/h2-6,12,14,16,20,23H,7-11H2,1H3/t14-,16-,19+/m0/s1 |
| InChIKey | DHFLQYYKACDEPW-URLQWDBASA-N |
| XLogP | 1.31 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |