C20H29N3O2S — CID 118782853
2-[(2-methylphenyl)methylsulfanyl]-N-[1-(pyrrolidine-1-carbonyl)piperidin-4-yl]acetamide (PubChem CID 118782853) has the molecular formula C20H29N3O2S and a molecular weight of 375.54 g/mol. Its IUPAC name is 2-[(2-methylphenyl)methylsulfanyl]-N-[1-(pyrrolidine-1-carbonyl)piperidin-4-yl]acetamide.
| Compound Name | 2-[(2-methylphenyl)methylsulfanyl]-N-[1-(pyrrolidine-1-carbonyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 118782853 |
| Molecular Formula | C20H29N3O2S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 2-[(2-methylphenyl)methylsulfanyl]-N-[1-(pyrrolidine-1-carbonyl)piperidin-4-yl]acetamide |
| SMILES | Cc1ccccc1CSCC(=O)NC1CCN(C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C20H29N3O2S/c1-16-6-2-3-7-17(16)14-26-15-19(24)21-18-8-12-23(13-9-18)20(25)22-10-4-5-11-22/h2-3,6-7,18H,4-5,8-15H2,1H3,(H,21,24) |
| InChIKey | JZWHLTYEQSEVLF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |