C19H24ClN3O3 — CID 118783105
3-(2-chloro-5-morpholin-4-ylphenyl)-1-ethyl-1-[(5-methylfuran-2-yl)methyl]urea (PubChem CID 118783105) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is 3-(2-chloro-5-morpholin-4-ylphenyl)-1-ethyl-1-[(5-methylfuran-2-yl)methyl]urea.
| Compound Name | 3-(2-chloro-5-morpholin-4-ylphenyl)-1-ethyl-1-[(5-methylfuran-2-yl)methyl]urea |
|---|---|
| PubChem CID | 118783105 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 3-(2-chloro-5-morpholin-4-ylphenyl)-1-ethyl-1-[(5-methylfuran-2-yl)methyl]urea |
| SMILES | CCN(Cc1ccc(C)o1)C(=O)Nc1cc(N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C19H24ClN3O3/c1-3-22(13-16-6-4-14(2)26-16)19(24)21-18-12-15(5-7-17(18)20)23-8-10-25-11-9-23/h4-7,12H,3,8-11,13H2,1-2H3,(H,21,24) |
| InChIKey | GUPGSULNUHZMGZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |