C23H22FN2O2+ — CID 11878352
(3R,7aR)-2-(4-fluorophenyl)-3-(2-methoxynaphthalen-1-yl)-3,4,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-4-ium-1-one (PubChem CID 11878352) has the molecular formula C23H22FN2O2+ and a molecular weight of 377.44 g/mol. Its IUPAC name is (3R,7aR)-2-(4-fluorophenyl)-3-(2-methoxynaphthalen-1-yl)-3,4,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-4-ium-1-one.
| Compound Name | (3R,7aR)-2-(4-fluorophenyl)-3-(2-methoxynaphthalen-1-yl)-3,4,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-4-ium-1-one |
|---|---|
| PubChem CID | 11878352 |
| Molecular Formula | C23H22FN2O2+ |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (3R,7aR)-2-(4-fluorophenyl)-3-(2-methoxynaphthalen-1-yl)-3,4,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-4-ium-1-one |
| SMILES | COc1ccc2ccccc2c1[C@@H]1N(c2ccc(F)cc2)C(=O)[C@H]2CCC[NH+]21 |
| InChI | InChI=1S/C23H21FN2O2/c1-28-20-13-8-15-5-2-3-6-18(15)21(20)22-25-14-4-7-19(25)23(27)26(22)17-11-9-16(24)10-12-17/h2-3,5-6,8-13,19,22H,4,7,14H2,1H3/p+1/t19-,22+/m1/s1 |
| InChIKey | CKCYUEFZCAIOJU-KNQAVFIVSA-O |
| XLogP | 3.08 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |