C16H24N6O — CID 118783565
(1S,9S)-11-[(2-butyl-1H-imidazol-5-yl)methyl]-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene (PubChem CID 118783565) has the molecular formula C16H24N6O and a molecular weight of 316.41 g/mol. Its IUPAC name is (1S,9S)-11-[(2-butyl-1H-imidazol-5-yl)methyl]-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene.
| Compound Name | (1S,9S)-11-[(2-butyl-1H-imidazol-5-yl)methyl]-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene |
|---|---|
| PubChem CID | 118783565 |
| Molecular Formula | C16H24N6O |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (1S,9S)-11-[(2-butyl-1H-imidazol-5-yl)methyl]-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene |
| SMILES | CCCCc1ncc(CN2CC[C@H]3[C@H](C2)OCc2cnnn23)[nH]1 |
| InChI | InChI=1S/C16H24N6O/c1-2-3-4-16-17-7-12(19-16)9-21-6-5-14-15(10-21)23-11-13-8-18-20-22(13)14/h7-8,14-15H,2-6,9-11H2,1H3,(H,17,19)/t14-,15-/m0/s1 |
| InChIKey | GCRLVIZFBDVMIZ-GJZGRUSLSA-N |
| XLogP | 1.69 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |