About [(3S,4R,5R)-5-phenyl-1-azoniabicyclo[2.2.2]octan-3-yl] acetate
[(3S,4R,5R)-5-phenyl-1-azoniabicyclo[2.2.2]octan-3-yl] acetate (PubChem CID 11878394) has the molecular formula C15H20NO2+
and a molecular weight of 246.33 g/mol. Its IUPAC name is [(3S,4R,5R)-5-phenyl-1-azoniabicyclo[2.2.2]octan-3-yl] acetate.
Molecular Properties
| Compound Name | [(3S,4R,5R)-5-phenyl-1-azoniabicyclo[2.2.2]octan-3-yl] acetate |
| PubChem CID | 11878394 |
| Molecular Formula | C15H20NO2+ |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | [(3S,4R,5R)-5-phenyl-1-azoniabicyclo[2.2.2]octan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[NH+]2CC[C@@H]1[C@H](c1ccccc1)C2 |
| InChI | InChI=1S/C15H19NO2/c1-11(17)18-15-10-16-8-7-13(15)14(9-16)12-5-3-2-4-6-12/h2-6,13-15H,7-10H2,1H3/p+1/t13-,14+,15-/m1/s1 |
| InChIKey | HZJHUAKXMXQRMD-QLFBSQMISA-O |
| XLogP | 0.62 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3S,4R,5R)-5-phenyl-1-azoniabicyclo[2.2.2]octan-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R,5R)-5-phenyl-1-azoniabicyclo[2.2.2]octan-3-yl] acetate?
The IUPAC name of [(3S,4R,5R)-5-phenyl-1-azoniabicyclo[2.2.2]octan-3-yl] acetate (CID 11878394) is [(3S,4R,5R)-5-phenyl-1-azoniabicyclo[2.2.2]octan-3-yl] acetate.
What is the SMILES notation for [(3S,4R,5R)-5-phenyl-1-azoniabicyclo[2.2.2]octan-3-yl] acetate?
The canonical SMILES for [(3S,4R,5R)-5-phenyl-1-azoniabicyclo[2.2.2]octan-3-yl] acetate is CC(=O)O[C@@H]1C[NH+]2CC[C@@H]1[C@H](c1ccccc1)C2.
What is the InChIKey of [(3S,4R,5R)-5-phenyl-1-azoniabicyclo[2.2.2]octan-3-yl] acetate?
The InChIKey is HZJHUAKXMXQRMD-QLFBSQMISA-O. The full InChI is InChI=1S/C15H19NO2/c1-11(17)18-15-10-16-8-7-13(15)14(9-16)12-5-3-2-4-6-12/h2-6,13-15H,7-10H2,1H3/p+1/t13-,14+,15-/m1/s1.
What are the key properties of [(3S,4R,5R)-5-phenyl-1-azoniabicyclo[2.2.2]octan-3-yl] acetate?
[(3S,4R,5R)-5-phenyl-1-azoniabicyclo[2.2.2]octan-3-yl] acetate has a molecular weight of 246.33 g/mol, XLogP of 0.62, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R,5R)-5-phenyl-1-azoniabicyclo[2.2.2]octan-3-yl] acetate is sourced from PubChem (CID 11878394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).