C21H23FO6 — CID 11878639
bis(prop-2-enyl) (1R,2R,3S,4R)-2-(4-fluorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate (PubChem CID 11878639) has the molecular formula C21H23FO6 and a molecular weight of 390.41 g/mol. Its IUPAC name is bis(prop-2-enyl) (1R,2R,3S,4R)-2-(4-fluorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate.
| Compound Name | bis(prop-2-enyl) (1R,2R,3S,4R)-2-(4-fluorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 11878639 |
| Molecular Formula | C21H23FO6 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | bis(prop-2-enyl) (1R,2R,3S,4R)-2-(4-fluorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
| SMILES | C=CCOC(=O)[C@H]1C(=O)C[C@@](C)(O)[C@@H](C(=O)OCC=C)[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C21H23FO6/c1-4-10-27-19(24)17-15(23)12-21(3,26)18(20(25)28-11-5-2)16(17)13-6-8-14(22)9-7-13/h4-9,16-18,26H,1-2,10-12H2,3H3/t16-,17-,18+,21+/m0/s1 |
| InChIKey | RNKCJFOKJLSLEY-LXGFNABISA-N |
| XLogP | 2.32 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|