C14H21N3O2 — CID 118786851
1-(2,5-dimethylphenyl)-3-[(3R,4R)-4-hydroxypiperidin-3-yl]urea (PubChem CID 118786851) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-[(3R,4R)-4-hydroxypiperidin-3-yl]urea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-[(3R,4R)-4-hydroxypiperidin-3-yl]urea |
|---|---|
| PubChem CID | 118786851 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-[(3R,4R)-4-hydroxypiperidin-3-yl]urea |
| SMILES | Cc1ccc(C)c(NC(=O)N[C@@H]2CNCC[C@H]2O)c1 |
| InChI | InChI=1S/C14H21N3O2/c1-9-3-4-10(2)11(7-9)16-14(19)17-12-8-15-6-5-13(12)18/h3-4,7,12-13,15,18H,5-6,8H2,1-2H3,(H2,16,17,19)/t12-,13-/m1/s1 |
| InChIKey | NMQWYWLRNYOMIS-CHWSQXEVSA-N |
| XLogP | 1.15 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |