C18H27N3O4 — CID 118786906
4-[(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-6-tert-butyl-1H-pyrimidin-2-one (PubChem CID 118786906) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is 4-[(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-6-tert-butyl-1H-pyrimidin-2-one.
| Compound Name | 4-[(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-6-tert-butyl-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 118786906 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 4-[(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-6-tert-butyl-1H-pyrimidin-2-one |
| SMILES | CO[C@@]12CC[C@H](O)C[C@@H]1N(C(=O)c1cc(C(C)(C)C)[nH]c(=O)n1)CC2 |
| InChI | InChI=1S/C18H27N3O4/c1-17(2,3)13-10-12(19-16(24)20-13)15(23)21-8-7-18(25-4)6-5-11(22)9-14(18)21/h10-11,14,22H,5-9H2,1-4H3,(H,19,20,24)/t11-,14-,18+/m0/s1 |
| InChIKey | SZQOFRUXFIOVIM-KQYVJACZSA-N |
| XLogP | 1.21 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |