C16H23N5O2 — CID 118787676
2-[(1-methylimidazol-2-yl)methyl-[2-methyl-6-(oxolan-3-yl)pyrimidin-4-yl]amino]ethanol (PubChem CID 118787676) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-[(1-methylimidazol-2-yl)methyl-[2-methyl-6-(oxolan-3-yl)pyrimidin-4-yl]amino]ethanol.
| Compound Name | 2-[(1-methylimidazol-2-yl)methyl-[2-methyl-6-(oxolan-3-yl)pyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 118787676 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 2-[(1-methylimidazol-2-yl)methyl-[2-methyl-6-(oxolan-3-yl)pyrimidin-4-yl]amino]ethanol |
| SMILES | Cc1nc(C2CCOC2)cc(N(CCO)Cc2nccn2C)n1 |
| InChI | InChI=1S/C16H23N5O2/c1-12-18-14(13-3-8-23-11-13)9-15(19-12)21(6-7-22)10-16-17-4-5-20(16)2/h4-5,9,13,22H,3,6-8,10-11H2,1-2H3 |
| InChIKey | HBXCFDIPKIHHFO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |