About 1-methyl-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]indole-4-carboxamide
1-methyl-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]indole-4-carboxamide (PubChem CID 118788686) has the molecular formula C19H25N3O2
and a molecular weight of 327.43 g/mol. Its IUPAC name is 1-methyl-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]indole-4-carboxamide.
Molecular Properties
| Compound Name | 1-methyl-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]indole-4-carboxamide |
| PubChem CID | 118788686 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 1-methyl-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]indole-4-carboxamide |
| SMILES | Cn1ccc2c(C(=O)N[C@H]3COC[C@@H]3N3CCCCC3)cccc21 |
| InChI | InChI=1S/C19H25N3O2/c1-21-11-8-14-15(6-5-7-17(14)21)19(23)20-16-12-24-13-18(16)22-9-3-2-4-10-22/h5-8,11,16,18H,2-4,9-10,12-13H2,1H3,(H,20,23)/t16-,18-/m0/s1 |
| InChIKey | UHAGSOZYGRNVDQ-WMZOPIPTSA-N |
| XLogP | 2.16 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]indole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]indole-4-carboxamide?
The IUPAC name of 1-methyl-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]indole-4-carboxamide (CID 118788686) is 1-methyl-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]indole-4-carboxamide.
What is the SMILES notation for 1-methyl-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]indole-4-carboxamide?
The canonical SMILES for 1-methyl-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]indole-4-carboxamide is Cn1ccc2c(C(=O)N[C@H]3COC[C@@H]3N3CCCCC3)cccc21.
What is the InChIKey of 1-methyl-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]indole-4-carboxamide?
The InChIKey is UHAGSOZYGRNVDQ-WMZOPIPTSA-N. The full InChI is InChI=1S/C19H25N3O2/c1-21-11-8-14-15(6-5-7-17(14)21)19(23)20-16-12-24-13-18(16)22-9-3-2-4-10-22/h5-8,11,16,18H,2-4,9-10,12-13H2,1H3,(H,20,23)/t16-,18-/m0/s1.
What are the key properties of 1-methyl-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]indole-4-carboxamide?
1-methyl-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]indole-4-carboxamide has a molecular weight of 327.43 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]indole-4-carboxamide is sourced from PubChem (CID 118788686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).