C16H23N7O — CID 118789062
1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-4-(1H-pyrazol-4-yl)butan-1-one (PubChem CID 118789062) has the molecular formula C16H23N7O and a molecular weight of 329.41 g/mol. Its IUPAC name is 1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-4-(1H-pyrazol-4-yl)butan-1-one.
| Compound Name | 1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-4-(1H-pyrazol-4-yl)butan-1-one |
|---|---|
| PubChem CID | 118789062 |
| Molecular Formula | C16H23N7O |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-4-(1H-pyrazol-4-yl)butan-1-one |
| SMILES | Cc1cc(N2CCN(C(=O)CCCc3cn[nH]c3)CC2)nc(N)n1 |
| InChI | InChI=1S/C16H23N7O/c1-12-9-14(21-16(17)20-12)22-5-7-23(8-6-22)15(24)4-2-3-13-10-18-19-11-13/h9-11H,2-8H2,1H3,(H,18,19)(H2,17,20,21) |
| InChIKey | UIWKKBLTOZWWQB-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |