About 1-[(1R,5S)-8-(dimethylamino)-3-azabicyclo[3.2.1]octan-3-yl]-2-(triazol-2-yl)ethanone
1-[(1R,5S)-8-(dimethylamino)-3-azabicyclo[3.2.1]octan-3-yl]-2-(triazol-2-yl)ethanone (PubChem CID 118789103) has the molecular formula C13H21N5O
and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-[(1R,5S)-8-(dimethylamino)-3-azabicyclo[3.2.1]octan-3-yl]-2-(triazol-2-yl)ethanone.
Molecular Properties
| Compound Name | 1-[(1R,5S)-8-(dimethylamino)-3-azabicyclo[3.2.1]octan-3-yl]-2-(triazol-2-yl)ethanone |
| PubChem CID | 118789103 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 1-[(1R,5S)-8-(dimethylamino)-3-azabicyclo[3.2.1]octan-3-yl]-2-(triazol-2-yl)ethanone |
| SMILES | CN(C)C1[C@@H]2CC[C@H]1CN(C(=O)Cn1nccn1)C2 |
| InChI | InChI=1S/C13H21N5O/c1-16(2)13-10-3-4-11(13)8-17(7-10)12(19)9-18-14-5-6-15-18/h5-6,10-11,13H,3-4,7-9H2,1-2H3/t10-,11+,13? |
| InChIKey | LGNLJLWYJYDRDF-QYJAPNMZSA-N |
| XLogP | 0.08 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(1R,5S)-8-(dimethylamino)-3-azabicyclo[3.2.1]octan-3-yl]-2-(triazol-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,5S)-8-(dimethylamino)-3-azabicyclo[3.2.1]octan-3-yl]-2-(triazol-2-yl)ethanone?
The IUPAC name of 1-[(1R,5S)-8-(dimethylamino)-3-azabicyclo[3.2.1]octan-3-yl]-2-(triazol-2-yl)ethanone (CID 118789103) is 1-[(1R,5S)-8-(dimethylamino)-3-azabicyclo[3.2.1]octan-3-yl]-2-(triazol-2-yl)ethanone.
What is the SMILES notation for 1-[(1R,5S)-8-(dimethylamino)-3-azabicyclo[3.2.1]octan-3-yl]-2-(triazol-2-yl)ethanone?
The canonical SMILES for 1-[(1R,5S)-8-(dimethylamino)-3-azabicyclo[3.2.1]octan-3-yl]-2-(triazol-2-yl)ethanone is CN(C)C1[C@@H]2CC[C@H]1CN(C(=O)Cn1nccn1)C2.
What is the InChIKey of 1-[(1R,5S)-8-(dimethylamino)-3-azabicyclo[3.2.1]octan-3-yl]-2-(triazol-2-yl)ethanone?
The InChIKey is LGNLJLWYJYDRDF-QYJAPNMZSA-N. The full InChI is InChI=1S/C13H21N5O/c1-16(2)13-10-3-4-11(13)8-17(7-10)12(19)9-18-14-5-6-15-18/h5-6,10-11,13H,3-4,7-9H2,1-2H3/t10-,11+,13?.
What are the key properties of 1-[(1R,5S)-8-(dimethylamino)-3-azabicyclo[3.2.1]octan-3-yl]-2-(triazol-2-yl)ethanone?
1-[(1R,5S)-8-(dimethylamino)-3-azabicyclo[3.2.1]octan-3-yl]-2-(triazol-2-yl)ethanone has a molecular weight of 263.34 g/mol, XLogP of 0.08, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,5S)-8-(dimethylamino)-3-azabicyclo[3.2.1]octan-3-yl]-2-(triazol-2-yl)ethanone is sourced from PubChem (CID 118789103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).