C13H16N6O2 — CID 118789953
(1-methylpyrazol-4-yl)-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone (PubChem CID 118789953) has the molecular formula C13H16N6O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is (1-methylpyrazol-4-yl)-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone.
| Compound Name | (1-methylpyrazol-4-yl)-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone |
|---|---|
| PubChem CID | 118789953 |
| Molecular Formula | C13H16N6O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | (1-methylpyrazol-4-yl)-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone |
| SMILES | Cn1cc(C(=O)N2CC[C@H]3[C@H](C2)OCc2cnnn23)cn1 |
| InChI | InChI=1S/C13H16N6O2/c1-17-6-9(4-15-17)13(20)18-3-2-11-12(7-18)21-8-10-5-14-16-19(10)11/h4-6,11-12H,2-3,7-8H2,1H3/t11-,12-/m0/s1 |
| InChIKey | VBGVOHNEMPSKSS-RYUDHWBXSA-N |
| XLogP | -0.00 |
| TPSA | 78.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |