C19H22FN3O3 — CID 118790408
[(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[5-(3-fluorophenyl)-1H-pyrazol-4-yl]methanone (PubChem CID 118790408) has the molecular formula C19H22FN3O3 and a molecular weight of 359.40 g/mol. Its IUPAC name is [(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[5-(3-fluorophenyl)-1H-pyrazol-4-yl]methanone.
| Compound Name | [(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[5-(3-fluorophenyl)-1H-pyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 118790408 |
| Molecular Formula | C19H22FN3O3 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | [(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[5-(3-fluorophenyl)-1H-pyrazol-4-yl]methanone |
| SMILES | CO[C@@]12CC[C@H](O)C[C@@H]1N(C(=O)c1cn[nH]c1-c1cccc(F)c1)CC2 |
| InChI | InChI=1S/C19H22FN3O3/c1-26-19-6-5-14(24)10-16(19)23(8-7-19)18(25)15-11-21-22-17(15)12-3-2-4-13(20)9-12/h2-4,9,11,14,16,24H,5-8,10H2,1H3,(H,21,22)/t14-,16-,19+/m0/s1 |
| InChIKey | WXTXYANXELLVJL-URLQWDBASA-N |
| XLogP | 2.36 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |