C18H22FN3O2S — CID 118791445
2-(3-aminopropoxy)-5-fluoro-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)benzamide (PubChem CID 118791445) has the molecular formula C18H22FN3O2S and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-(3-aminopropoxy)-5-fluoro-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)benzamide.
| Compound Name | 2-(3-aminopropoxy)-5-fluoro-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 118791445 |
| Molecular Formula | C18H22FN3O2S |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 2-(3-aminopropoxy)-5-fluoro-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)benzamide |
| SMILES | NCCCOc1ccc(F)cc1C(=O)NCc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C18H22FN3O2S/c19-12-6-7-15(24-9-3-8-20)13(10-12)18(23)21-11-17-22-14-4-1-2-5-16(14)25-17/h6-7,10H,1-5,8-9,11,20H2,(H,21,23) |
| InChIKey | NKCVMELCHQABKS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|