C14H20N6O3S — CID 118791969
(1S,9S)-11-(1,3,5-trimethylpyrazol-4-yl)sulfonyl-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene (PubChem CID 118791969) has the molecular formula C14H20N6O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is (1S,9S)-11-(1,3,5-trimethylpyrazol-4-yl)sulfonyl-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene.
| Compound Name | (1S,9S)-11-(1,3,5-trimethylpyrazol-4-yl)sulfonyl-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene |
|---|---|
| PubChem CID | 118791969 |
| Molecular Formula | C14H20N6O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (1S,9S)-11-(1,3,5-trimethylpyrazol-4-yl)sulfonyl-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)N1CC[C@H]2[C@H](C1)OCc1cnnn12 |
| InChI | InChI=1S/C14H20N6O3S/c1-9-14(10(2)18(3)16-9)24(21,22)19-5-4-12-13(7-19)23-8-11-6-15-17-20(11)12/h6,12-13H,4-5,7-8H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | ABGQWBOGHYXMFZ-STQMWFEESA-N |
| XLogP | 0.16 |
| TPSA | 95.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |