About 1-acetyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]piperidine-2-carboxamide
1-acetyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]piperidine-2-carboxamide (PubChem CID 118792053) has the molecular formula C16H24N4O3
and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-acetyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]piperidine-2-carboxamide.
Molecular Properties
| Compound Name | 1-acetyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]piperidine-2-carboxamide |
| PubChem CID | 118792053 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 1-acetyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]piperidine-2-carboxamide |
| SMILES | CC(=O)N1CCCCC1C(=O)NCCn1c(C)cc(C)nc1=O |
| InChI | InChI=1S/C16H24N4O3/c1-11-10-12(2)19(16(23)18-11)9-7-17-15(22)14-6-4-5-8-20(14)13(3)21/h10,14H,4-9H2,1-3H3,(H,17,22) |
| InChIKey | HVUNMZQNUGNZIF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-acetyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]piperidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]piperidine-2-carboxamide?
The IUPAC name of 1-acetyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]piperidine-2-carboxamide (CID 118792053) is 1-acetyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]piperidine-2-carboxamide.
What is the SMILES notation for 1-acetyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]piperidine-2-carboxamide?
The canonical SMILES for 1-acetyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]piperidine-2-carboxamide is CC(=O)N1CCCCC1C(=O)NCCn1c(C)cc(C)nc1=O.
What is the InChIKey of 1-acetyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]piperidine-2-carboxamide?
The InChIKey is HVUNMZQNUGNZIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4O3/c1-11-10-12(2)19(16(23)18-11)9-7-17-15(22)14-6-4-5-8-20(14)13(3)21/h10,14H,4-9H2,1-3H3,(H,17,22).
What are the key properties of 1-acetyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]piperidine-2-carboxamide?
1-acetyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]piperidine-2-carboxamide has a molecular weight of 320.39 g/mol, XLogP of 0.38, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]piperidine-2-carboxamide is sourced from PubChem (CID 118792053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).