C17H22ClN3O3 — CID 118793030
1-[1-(3-chloropyridine-4-carbonyl)piperidin-4-yl]piperidine-3-carboxylic acid (PubChem CID 118793030) has the molecular formula C17H22ClN3O3 and a molecular weight of 351.83 g/mol. Its IUPAC name is 1-[1-(3-chloropyridine-4-carbonyl)piperidin-4-yl]piperidine-3-carboxylic acid.
| Compound Name | 1-[1-(3-chloropyridine-4-carbonyl)piperidin-4-yl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 118793030 |
| Molecular Formula | C17H22ClN3O3 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1-[1-(3-chloropyridine-4-carbonyl)piperidin-4-yl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C2CCN(C(=O)c3ccncc3Cl)CC2)C1 |
| InChI | InChI=1S/C17H22ClN3O3/c18-15-10-19-6-3-14(15)16(22)20-8-4-13(5-9-20)21-7-1-2-12(11-21)17(23)24/h3,6,10,12-13H,1-2,4-5,7-9,11H2,(H,23,24) |
| InChIKey | OTPJBNNVWKVGEP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |