C12H10N4O — CID 11879314
(1S,2R,6R,7R)-3-amino-5-oxo-4-azatricyclo[5.2.2.02,6]undeca-3,8-diene-2,6-dicarbonitrile (PubChem CID 11879314) has the molecular formula C12H10N4O and a molecular weight of 226.24 g/mol. Its IUPAC name is (1S,2R,6R,7R)-3-amino-5-oxo-4-azatricyclo[5.2.2.02,6]undeca-3,8-diene-2,6-dicarbonitrile.
| Compound Name | (1S,2R,6R,7R)-3-amino-5-oxo-4-azatricyclo[5.2.2.02,6]undeca-3,8-diene-2,6-dicarbonitrile |
|---|---|
| PubChem CID | 11879314 |
| Molecular Formula | C12H10N4O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | (1S,2R,6R,7R)-3-amino-5-oxo-4-azatricyclo[5.2.2.02,6]undeca-3,8-diene-2,6-dicarbonitrile |
| SMILES | N#C[C@]12C(N)=NC(=O)[C@]1(C#N)[C@H]1C=C[C@@H]2CC1 |
| InChI | InChI=1S/C12H10N4O/c13-5-11-7-1-3-8(4-2-7)12(11,6-14)10(17)16-9(11)15/h1,3,7-8H,2,4H2,(H2,15,16,17)/t7-,8+,11+,12+/m1/s1 |
| InChIKey | FVTQZXNSAZZPOO-ULCXWNMLSA-N |
| XLogP | 0.50 |
| TPSA | 103.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|