C18H24N4O3 — CID 118794768
[(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(6-methylpyrazolo[1,5-a]pyrimidin-3-yl)methanone (PubChem CID 118794768) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is [(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(6-methylpyrazolo[1,5-a]pyrimidin-3-yl)methanone.
| Compound Name | [(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(6-methylpyrazolo[1,5-a]pyrimidin-3-yl)methanone |
|---|---|
| PubChem CID | 118794768 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | [(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(6-methylpyrazolo[1,5-a]pyrimidin-3-yl)methanone |
| SMILES | CO[C@H]1CC[C@@]2(OC)CCN(C(=O)c3cnn4cc(C)cnc34)[C@H]2C1 |
| InChI | InChI=1S/C18H24N4O3/c1-12-9-19-16-14(10-20-22(16)11-12)17(23)21-7-6-18(25-3)5-4-13(24-2)8-15(18)21/h9-11,13,15H,4-8H2,1-3H3/t13-,15-,18+/m0/s1 |
| InChIKey | BYAOQNPLXOGHPW-DHSIGJKJSA-N |
| XLogP | 1.84 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |