About 2-[(3R,4S)-1-(4-chloro-1H-pyrrole-2-carbonyl)-4-(2H-triazol-4-yl)pyrrolidin-3-yl]acetic acid
2-[(3R,4S)-1-(4-chloro-1H-pyrrole-2-carbonyl)-4-(2H-triazol-4-yl)pyrrolidin-3-yl]acetic acid (PubChem CID 118794802) has the molecular formula C13H14ClN5O3
and a molecular weight of 323.74 g/mol. Its IUPAC name is 2-[(3R,4S)-1-(4-chloro-1H-pyrrole-2-carbonyl)-4-(2H-triazol-4-yl)pyrrolidin-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(3R,4S)-1-(4-chloro-1H-pyrrole-2-carbonyl)-4-(2H-triazol-4-yl)pyrrolidin-3-yl]acetic acid |
| PubChem CID | 118794802 |
| Molecular Formula | C13H14ClN5O3 |
| Molecular Weight | 323.74 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 2-[(3R,4S)-1-(4-chloro-1H-pyrrole-2-carbonyl)-4-(2H-triazol-4-yl)pyrrolidin-3-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1CN(C(=O)c2cc(Cl)c[nH]2)C[C@H]1c1cn[nH]n1 |
| InChI | InChI=1S/C13H14ClN5O3/c14-8-2-10(15-3-8)13(22)19-5-7(1-12(20)21)9(6-19)11-4-16-18-17-11/h2-4,7,9,15H,1,5-6H2,(H,20,21)(H,16,17,18)/t7-,9+/m0/s1 |
| InChIKey | IYZPOYYYUHDLMZ-IONNQARKSA-N |
| XLogP | 1.12 |
| TPSA | 114.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.74 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(3R,4S)-1-(4-chloro-1H-pyrrole-2-carbonyl)-4-(2H-triazol-4-yl)pyrrolidin-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R,4S)-1-(4-chloro-1H-pyrrole-2-carbonyl)-4-(2H-triazol-4-yl)pyrrolidin-3-yl]acetic acid?
The IUPAC name of 2-[(3R,4S)-1-(4-chloro-1H-pyrrole-2-carbonyl)-4-(2H-triazol-4-yl)pyrrolidin-3-yl]acetic acid (CID 118794802) is 2-[(3R,4S)-1-(4-chloro-1H-pyrrole-2-carbonyl)-4-(2H-triazol-4-yl)pyrrolidin-3-yl]acetic acid.
What is the SMILES notation for 2-[(3R,4S)-1-(4-chloro-1H-pyrrole-2-carbonyl)-4-(2H-triazol-4-yl)pyrrolidin-3-yl]acetic acid?
The canonical SMILES for 2-[(3R,4S)-1-(4-chloro-1H-pyrrole-2-carbonyl)-4-(2H-triazol-4-yl)pyrrolidin-3-yl]acetic acid is O=C(O)C[C@H]1CN(C(=O)c2cc(Cl)c[nH]2)C[C@H]1c1cn[nH]n1.
What is the InChIKey of 2-[(3R,4S)-1-(4-chloro-1H-pyrrole-2-carbonyl)-4-(2H-triazol-4-yl)pyrrolidin-3-yl]acetic acid?
The InChIKey is IYZPOYYYUHDLMZ-IONNQARKSA-N. The full InChI is InChI=1S/C13H14ClN5O3/c14-8-2-10(15-3-8)13(22)19-5-7(1-12(20)21)9(6-19)11-4-16-18-17-11/h2-4,7,9,15H,1,5-6H2,(H,20,21)(H,16,17,18)/t7-,9+/m0/s1.
What are the key properties of 2-[(3R,4S)-1-(4-chloro-1H-pyrrole-2-carbonyl)-4-(2H-triazol-4-yl)pyrrolidin-3-yl]acetic acid?
2-[(3R,4S)-1-(4-chloro-1H-pyrrole-2-carbonyl)-4-(2H-triazol-4-yl)pyrrolidin-3-yl]acetic acid has a molecular weight of 323.74 g/mol, XLogP of 1.12, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R,4S)-1-(4-chloro-1H-pyrrole-2-carbonyl)-4-(2H-triazol-4-yl)pyrrolidin-3-yl]acetic acid is sourced from PubChem (CID 118794802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).