C23H27N7O4 — CID 11879576
1-[(3S,3aR,6S,6aR)-6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-benzylurea (PubChem CID 11879576) has the molecular formula C23H27N7O4 and a molecular weight of 465.51 g/mol. Its IUPAC name is 1-[(3S,3aR,6S,6aR)-6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-benzylurea.
| Compound Name | 1-[(3S,3aR,6S,6aR)-6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-benzylurea |
|---|---|
| PubChem CID | 11879576 |
| Molecular Formula | C23H27N7O4 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 1-[(3S,3aR,6S,6aR)-6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-benzylurea |
| SMILES | CN(C)c1cccc(Oc2nnnn2[C@H]2CO[C@H]3[C@@H]2OC[C@@H]3NC(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C23H27N7O4/c1-29(2)16-9-6-10-17(11-16)34-23-26-27-28-30(23)19-14-33-20-18(13-32-21(19)20)25-22(31)24-12-15-7-4-3-5-8-15/h3-11,18-21H,12-14H2,1-2H3,(H2,24,25,31)/t18-,19-,20+,21+/m0/s1 |
| InChIKey | SOZHITFKFSZGNO-UWHLTILDSA-N |
| XLogP | 1.74 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |