C27H38N2O2S — CID 118796093
N-[(1R,2R)-1'-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-2-methoxyspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]-2-methylsulfanylacetamide (PubChem CID 118796093) has the molecular formula C27H38N2O2S and a molecular weight of 454.68 g/mol. Its IUPAC name is N-[(1R,2R)-1'-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-2-methoxyspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]-2-methylsulfanylacetamide.
| Compound Name | N-[(1R,2R)-1'-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-2-methoxyspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 118796093 |
| Molecular Formula | C27H38N2O2S |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | N-[(1R,2R)-1'-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-2-methoxyspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]-2-methylsulfanylacetamide |
| SMILES | CO[C@H]1[C@H](NC(=O)CSC)c2ccccc2C12CCN(CC1=CC[C@H]3C[C@@H]1C3(C)C)CC2 |
| InChI | InChI=1S/C27H38N2O2S/c1-26(2)19-10-9-18(22(26)15-19)16-29-13-11-27(12-14-29)21-8-6-5-7-20(21)24(25(27)31-3)28-23(30)17-32-4/h5-9,19,22,24-25H,10-17H2,1-4H3,(H,28,30)/t19-,22-,24+,25-/m0/s1 |
| InChIKey | PTNFMUGNZOZIPK-UGZNWAIPSA-N |
| XLogP | 4.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|