C16H22N2O4 — CID 118796120
5-[(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-2-methyl-1H-pyridin-4-one (PubChem CID 118796120) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 5-[(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-2-methyl-1H-pyridin-4-one.
| Compound Name | 5-[(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-2-methyl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 118796120 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 5-[(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-2-methyl-1H-pyridin-4-one |
| SMILES | CO[C@@]12CC[C@H](O)C[C@@H]1N(C(=O)c1c[nH]c(C)cc1=O)CC2 |
| InChI | InChI=1S/C16H22N2O4/c1-10-7-13(20)12(9-17-10)15(21)18-6-5-16(22-2)4-3-11(19)8-14(16)18/h7,9,11,14,19H,3-6,8H2,1-2H3,(H,17,20)/t11-,14-,16+/m0/s1 |
| InChIKey | HANUGRVWJVJCDG-HZUKXOBISA-N |
| XLogP | 0.83 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |