About 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-3-quinazolin-4-yloxypropan-2-ol
1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-3-quinazolin-4-yloxypropan-2-ol (PubChem CID 118796632) has the molecular formula C21H22Cl2N4O2
and a molecular weight of 433.34 g/mol. Its IUPAC name is 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-3-quinazolin-4-yloxypropan-2-ol.
Molecular Properties
| Compound Name | 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-3-quinazolin-4-yloxypropan-2-ol |
| PubChem CID | 118796632 |
| Molecular Formula | C21H22Cl2N4O2 |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-3-quinazolin-4-yloxypropan-2-ol |
| SMILES | OC(COc1ncnc2ccccc12)CN1CCN(c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C21H22Cl2N4O2/c22-18-6-5-15(11-19(18)23)27-9-7-26(8-10-27)12-16(28)13-29-21-17-3-1-2-4-20(17)24-14-25-21/h1-6,11,14,16,28H,7-10,12-13H2 |
| InChIKey | JRAVSSVQUHVZMC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-3-quinazolin-4-yloxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-3-quinazolin-4-yloxypropan-2-ol?
The IUPAC name of 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-3-quinazolin-4-yloxypropan-2-ol (CID 118796632) is 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-3-quinazolin-4-yloxypropan-2-ol.
What is the SMILES notation for 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-3-quinazolin-4-yloxypropan-2-ol?
The canonical SMILES for 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-3-quinazolin-4-yloxypropan-2-ol is OC(COc1ncnc2ccccc12)CN1CCN(c2ccc(Cl)c(Cl)c2)CC1.
What is the InChIKey of 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-3-quinazolin-4-yloxypropan-2-ol?
The InChIKey is JRAVSSVQUHVZMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22Cl2N4O2/c22-18-6-5-15(11-19(18)23)27-9-7-26(8-10-27)12-16(28)13-29-21-17-3-1-2-4-20(17)24-14-25-21/h1-6,11,14,16,28H,7-10,12-13H2.
What are the key properties of 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-3-quinazolin-4-yloxypropan-2-ol?
1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-3-quinazolin-4-yloxypropan-2-ol has a molecular weight of 433.34 g/mol, XLogP of 3.50, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-3-quinazolin-4-yloxypropan-2-ol is sourced from PubChem (CID 118796632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).