C23H23N3O4S — CID 118796658
4-[5-(4-ethoxyphenyl)-3-(2-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonamide (PubChem CID 118796658) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is 4-[5-(4-ethoxyphenyl)-3-(2-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonamide.
| Compound Name | 4-[5-(4-ethoxyphenyl)-3-(2-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 118796658 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 4-[5-(4-ethoxyphenyl)-3-(2-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonamide |
| SMILES | CCOc1ccc(C2=NN(c3ccc(S(N)(=O)=O)cc3)C(c3ccccc3O)C2)cc1 |
| InChI | InChI=1S/C23H23N3O4S/c1-2-30-18-11-7-16(8-12-18)21-15-22(20-5-3-4-6-23(20)27)26(25-21)17-9-13-19(14-10-17)31(24,28)29/h3-14,22,27H,2,15H2,1H3,(H2,24,28,29) |
| InChIKey | BELCFXPRQIHBNP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|