C24H30N7O2+ — CID 118796697
2-[[8-[(3S)-3-aminopiperidin-1-ium-1-ylidene]-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxo-5H-purin-1-yl]methyl]benzonitrile (PubChem CID 118796697) has the molecular formula C24H30N7O2+ and a molecular weight of 448.55 g/mol. Its IUPAC name is 2-[[8-[(3S)-3-aminopiperidin-1-ium-1-ylidene]-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxo-5H-purin-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[8-[(3S)-3-aminopiperidin-1-ium-1-ylidene]-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxo-5H-purin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 118796697 |
| Molecular Formula | C24H30N7O2+ |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 2-[[8-[(3S)-3-aminopiperidin-1-ium-1-ylidene]-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxo-5H-purin-1-yl]methyl]benzonitrile |
| SMILES | CC(C)=CCN1/C(=[N+]2/CCC[C@H](N)C2)N=C2C1C(=O)N(Cc1ccccc1C#N)C(=O)N2C |
| InChI | InChI=1S/C24H30N7O2/c1-16(2)10-12-30-20-21(27-23(30)29-11-6-9-19(26)15-29)28(3)24(33)31(22(20)32)14-18-8-5-4-7-17(18)13-25/h4-5,7-8,10,19-20H,6,9,11-12,14-15,26H2,1-3H3/q+1/t19-,20?/m0/s1 |
| InChIKey | MZSXWZBLDMGWBV-XJDOXCRVSA-N |
| XLogP | 1.49 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|