C24H30N7O2S+ — CID 118796698
8-[(3R)-3-aminopiperidin-1-ium-1-ylidene]-1-(1,3-benzothiazol-2-ylmethyl)-3-methyl-7-(3-methylbut-2-enyl)-5H-purine-2,6-dione (PubChem CID 118796698) has the molecular formula C24H30N7O2S+ and a molecular weight of 480.62 g/mol. Its IUPAC name is 8-[(3R)-3-aminopiperidin-1-ium-1-ylidene]-1-(1,3-benzothiazol-2-ylmethyl)-3-methyl-7-(3-methylbut-2-enyl)-5H-purine-2,6-dione.
| Compound Name | 8-[(3R)-3-aminopiperidin-1-ium-1-ylidene]-1-(1,3-benzothiazol-2-ylmethyl)-3-methyl-7-(3-methylbut-2-enyl)-5H-purine-2,6-dione |
|---|---|
| PubChem CID | 118796698 |
| Molecular Formula | C24H30N7O2S+ |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 8-[(3R)-3-aminopiperidin-1-ium-1-ylidene]-1-(1,3-benzothiazol-2-ylmethyl)-3-methyl-7-(3-methylbut-2-enyl)-5H-purine-2,6-dione |
| SMILES | CC(C)=CCN1/C(=[N+]2/CCC[C@@H](N)C2)N=C2C1C(=O)N(Cc1nc3ccccc3s1)C(=O)N2C |
| InChI | InChI=1S/C24H30N7O2S/c1-15(2)10-12-30-20-21(27-23(30)29-11-6-7-16(25)13-29)28(3)24(33)31(22(20)32)14-19-26-17-8-4-5-9-18(17)34-19/h4-5,8-10,16,20H,6-7,11-14,25H2,1-3H3/q+1/t16-,20?/m1/s1 |
| InChIKey | HQKYEHXUQXSBPD-QRIPLOBPSA-N |
| XLogP | 2.23 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|