C18H20FN4O2S+ — CID 118796845
7-[(N-ethyl-4-fluoroanilino)methyl]-N,2-dimethyl-5-oxo-3H-[1,3]thiazolo[3,2-a]pyrimidin-1-ium-3-carboxamide (PubChem CID 118796845) has the molecular formula C18H20FN4O2S+ and a molecular weight of 375.45 g/mol. Its IUPAC name is 7-[(N-ethyl-4-fluoroanilino)methyl]-N,2-dimethyl-5-oxo-3H-[1,3]thiazolo[3,2-a]pyrimidin-1-ium-3-carboxamide.
| Compound Name | 7-[(N-ethyl-4-fluoroanilino)methyl]-N,2-dimethyl-5-oxo-3H-[1,3]thiazolo[3,2-a]pyrimidin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 118796845 |
| Molecular Formula | C18H20FN4O2S+ |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 7-[(N-ethyl-4-fluoroanilino)methyl]-N,2-dimethyl-5-oxo-3H-[1,3]thiazolo[3,2-a]pyrimidin-1-ium-3-carboxamide |
| SMILES | CCN(Cc1cc(=O)n2c(n1)[S+]=C(C)C2C(=O)NC)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H19FN4O2S/c1-4-22(14-7-5-12(19)6-8-14)10-13-9-15(24)23-16(17(25)20-3)11(2)26-18(23)21-13/h5-9,16H,4,10H2,1-3H3/p+1 |
| InChIKey | IJBOVNKPEGZJPA-UHFFFAOYSA-O |
| XLogP | 1.34 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|