C12H10F18O2 — CID 118797041
1-ethoxy-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane;1-ethoxy-1,1,2,2,3,3,4,4,4-nonafluorobutane (PubChem CID 118797041) has the molecular formula C12H10F18O2 and a molecular weight of 528.17 g/mol. Its IUPAC name is 1-ethoxy-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane;1-ethoxy-1,1,2,2,3,3,4,4,4-nonafluorobutane.
| Compound Name | 1-ethoxy-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane;1-ethoxy-1,1,2,2,3,3,4,4,4-nonafluorobutane |
|---|---|
| PubChem CID | 118797041 |
| Molecular Formula | C12H10F18O2 |
| Molecular Weight | 528.17 g/mol |
| Exact Mass | 528.04 |
| IUPAC Name | 1-ethoxy-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane;1-ethoxy-1,1,2,2,3,3,4,4,4-nonafluorobutane |
| SMILES | CCOC(F)(F)C(F)(C(F)(F)F)C(F)(F)F.CCOC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/2C6H5F9O/c1-2-16-6(14,15)4(9,10)3(7,8)5(11,12)13;1-2-16-6(14,15)3(7,4(8,9)10)5(11,12)13/h2*2H2,1H3 |
| InChIKey | GBPUJUQSLWLDFG-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.17 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|