About 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;3-(oxiran-2-ylmethoxy)propane-1,2-diol
4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;3-(oxiran-2-ylmethoxy)propane-1,2-diol (PubChem CID 118797169) has the molecular formula C21H28O6
and a molecular weight of 376.45 g/mol. Its IUPAC name is 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;3-(oxiran-2-ylmethoxy)propane-1,2-diol.
Molecular Properties
| Compound Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;3-(oxiran-2-ylmethoxy)propane-1,2-diol |
| PubChem CID | 118797169 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;3-(oxiran-2-ylmethoxy)propane-1,2-diol |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.OCC(O)COCC1CO1 |
| InChI | InChI=1S/C15H16O2.C6H12O4/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;7-1-5(8)2-9-3-6-4-10-6/h3-10,16-17H,1-2H3;5-8H,1-4H2 |
| InChIKey | LUXUHSRMVFIVGX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;3-(oxiran-2-ylmethoxy)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;3-(oxiran-2-ylmethoxy)propane-1,2-diol?
The IUPAC name of 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;3-(oxiran-2-ylmethoxy)propane-1,2-diol (CID 118797169) is 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;3-(oxiran-2-ylmethoxy)propane-1,2-diol.
What is the SMILES notation for 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;3-(oxiran-2-ylmethoxy)propane-1,2-diol?
The canonical SMILES for 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;3-(oxiran-2-ylmethoxy)propane-1,2-diol is CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.OCC(O)COCC1CO1.
What is the InChIKey of 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;3-(oxiran-2-ylmethoxy)propane-1,2-diol?
The InChIKey is LUXUHSRMVFIVGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O2.C6H12O4/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;7-1-5(8)2-9-3-6-4-10-6/h3-10,16-17H,1-2H3;5-8H,1-4H2.
What are the key properties of 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;3-(oxiran-2-ylmethoxy)propane-1,2-diol?
4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;3-(oxiran-2-ylmethoxy)propane-1,2-diol has a molecular weight of 376.45 g/mol, XLogP of 2.18, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;3-(oxiran-2-ylmethoxy)propane-1,2-diol is sourced from PubChem (CID 118797169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).