C22H24N4O2S — CID 11879766
(8R,8aS)-7,7-dicyano-6-imino-8-(4-methylsulfanylphenyl)-2-propan-2-yl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5-carboxylate (PubChem CID 11879766) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is (8R,8aS)-7,7-dicyano-6-imino-8-(4-methylsulfanylphenyl)-2-propan-2-yl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5-carboxylate.
| Compound Name | (8R,8aS)-7,7-dicyano-6-imino-8-(4-methylsulfanylphenyl)-2-propan-2-yl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5-carboxylate |
|---|---|
| PubChem CID | 11879766 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | (8R,8aS)-7,7-dicyano-6-imino-8-(4-methylsulfanylphenyl)-2-propan-2-yl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5-carboxylate |
| SMILES | [H]/N=C1\C(C(=O)[O-])C2=CC[NH+](C(C)C)C[C@H]2[C@H](c2ccc(SC)cc2)C1(C#N)C#N |
| InChI | InChI=1S/C22H24N4O2S/c1-13(2)26-9-8-16-17(10-26)19(14-4-6-15(29-3)7-5-14)22(11-23,12-24)20(25)18(16)21(27)28/h4-8,13,17-19,25H,9-10H2,1-3H3,(H,27,28)/b25-20+/t17-,18?,19+/m1/s1 |
| InChIKey | VZRTVKLMGLNZFL-SKIFPDHXSA-N |
| XLogP | 0.77 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|