C23H26ClN3O6 — CID 118797786
6-chloro-2-hydroxy-N,N-dimethyl-3-[[2-[[(R)-(5-methylfuran-2-yl)-(3-methyloxetan-3-yl)methyl]amino]-3,4-dioxocyclobutyl]amino]benzamide (PubChem CID 118797786) has the molecular formula C23H26ClN3O6 and a molecular weight of 475.93 g/mol. Its IUPAC name is 6-chloro-2-hydroxy-N,N-dimethyl-3-[[2-[[(R)-(5-methylfuran-2-yl)-(3-methyloxetan-3-yl)methyl]amino]-3,4-dioxocyclobutyl]amino]benzamide.
| Compound Name | 6-chloro-2-hydroxy-N,N-dimethyl-3-[[2-[[(R)-(5-methylfuran-2-yl)-(3-methyloxetan-3-yl)methyl]amino]-3,4-dioxocyclobutyl]amino]benzamide |
|---|---|
| PubChem CID | 118797786 |
| Molecular Formula | C23H26ClN3O6 |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 6-chloro-2-hydroxy-N,N-dimethyl-3-[[2-[[(R)-(5-methylfuran-2-yl)-(3-methyloxetan-3-yl)methyl]amino]-3,4-dioxocyclobutyl]amino]benzamide |
| SMILES | Cc1ccc([C@H](NC2C(=O)C(=O)C2Nc2ccc(Cl)c(C(=O)N(C)C)c2O)C2(C)COC2)o1 |
| InChI | InChI=1S/C23H26ClN3O6/c1-11-5-8-14(33-11)21(23(2)9-32-10-23)26-17-16(19(29)20(17)30)25-13-7-6-12(24)15(18(13)28)22(31)27(3)4/h5-8,16-17,21,25-26,28H,9-10H2,1-4H3/t16?,17?,21-/m0/s1 |
| InChIKey | DBAMSFYQTBVSRW-BPZDKFOGSA-N |
| XLogP | 2.32 |
| TPSA | 121.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|