C8H17NO5 — CID 118797908
(2R,3S,4R,5S)-5-(1-hydroxyethylamino)-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 118797908) has the molecular formula C8H17NO5 and a molecular weight of 207.23 g/mol. Its IUPAC name is (2R,3S,4R,5S)-5-(1-hydroxyethylamino)-2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2R,3S,4R,5S)-5-(1-hydroxyethylamino)-2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 118797908 |
| Molecular Formula | C8H17NO5 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | (2R,3S,4R,5S)-5-(1-hydroxyethylamino)-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | CC(O)N[C@H]1CO[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H17NO5/c1-4(11)9-5-3-14-6(2-10)8(13)7(5)12/h4-13H,2-3H2,1H3/t4?,5-,6+,7+,8+/m0/s1 |
| InChIKey | WMTBOPQJAFKLMD-XUQKIGAKSA-N |
| XLogP | -2.60 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|